C28H35N5O2 — CID 11525733
N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]benzamide (PubChem CID 11525733) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]benzamide.
| Compound Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 11525733 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]benzamide |
| SMILES | CN1CCC(N(C)c2ccc(-c3ccc(C(=O)NC4(C(=O)NCC#N)CCCCC4)cc3)cc2)C1 |
| InChI | InChI=1S/C28H35N5O2/c1-32-19-14-25(20-32)33(2)24-12-10-22(11-13-24)21-6-8-23(9-7-21)26(34)31-28(15-4-3-5-16-28)27(35)30-18-17-29/h6-13,25H,3-5,14-16,18-20H2,1-2H3,(H,30,35)(H,31,34) |
| InChIKey | BDSZVNUUBYFZNJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|