C22H28N4O3 — CID 118367246
(3S,5R)-4-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 118367246) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3S,5R)-4-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | (3S,5R)-4-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 118367246 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (3S,5R)-4-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2C[C@@H](C)N(Cc3ccc(C(=O)NO)cc3)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-15-5-4-6-20(11-15)23-22(28)25-12-16(2)26(17(3)13-25)14-18-7-9-19(10-8-18)21(27)24-29/h4-11,16-17,29H,12-14H2,1-3H3,(H,23,28)(H,24,27)/t16-,17+ |
| InChIKey | HABOKONHKJAXIH-CALCHBBNSA-N |
| XLogP | 3.24 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|