C21H26ClN3O — CID 110658318
N-(3-chlorophenyl)-3,5-dimethyl-4-(2-phenylethyl)piperazine-1-carboxamide (PubChem CID 110658318) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3,5-dimethyl-4-(2-phenylethyl)piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3,5-dimethyl-4-(2-phenylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110658318 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(3-chlorophenyl)-3,5-dimethyl-4-(2-phenylethyl)piperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2cccc(Cl)c2)CC(C)N1CCc1ccccc1 |
| InChI | InChI=1S/C21H26ClN3O/c1-16-14-24(21(26)23-20-10-6-9-19(22)13-20)15-17(2)25(16)12-11-18-7-4-3-5-8-18/h3-10,13,16-17H,11-12,14-15H2,1-2H3,(H,23,26) |
| InChIKey | QAEFOLDNYSTXRN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |