C13H17ClN2O2 — CID 41097571
(2R,6R)-N-(3-chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 41097571) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is (2R,6R)-N-(3-chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | (2R,6R)-N-(3-chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 41097571 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2R,6R)-N-(3-chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2cccc(Cl)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-9-7-16(8-10(2)18-9)13(17)15-12-5-3-4-11(14)6-12/h3-6,9-10H,7-8H2,1-2H3,(H,15,17)/t9-,10-/m1/s1 |
| InChIKey | HHRIWYHSXVKMKP-NXEZZACHSA-N |
| XLogP | 2.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |