C22H29N3O2 — CID 135269536
4-[[2,6-dimethyl-4-(1-phenylethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 135269536) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-[[2,6-dimethyl-4-(1-phenylethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[2,6-dimethyl-4-(1-phenylethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135269536 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-[[2,6-dimethyl-4-(1-phenylethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC(c1ccccc1)N1CC(C)N(Cc2ccc(C(=O)NO)cc2)C(C)C1 |
| InChI | InChI=1S/C22H29N3O2/c1-16-13-24(18(3)20-7-5-4-6-8-20)14-17(2)25(16)15-19-9-11-21(12-10-19)22(26)23-27/h4-12,16-18,27H,13-15H2,1-3H3,(H,23,26) |
| InChIKey | YUNGIEUDKVLOSL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|