C22H23F6N3O2 — CID 118374041
4-[[(3S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylpiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 118374041) has the molecular formula C22H23F6N3O2 and a molecular weight of 475.43 g/mol. Its IUPAC name is 4-[[(3S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylpiperazin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 118374041 |
| Molecular Formula | C22H23F6N3O2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 4-[[(3S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylpiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | C[C@H]1CN(Cc2ccc(C(=O)NO)cc2)CCN1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F6N3O2/c1-14-11-30(12-15-2-4-17(5-3-15)20(32)29-33)6-7-31(14)13-16-8-18(21(23,24)25)10-19(9-16)22(26,27)28/h2-5,8-10,14,33H,6-7,11-13H2,1H3,(H,29,32)/t14-/m0/s1 |
| InChIKey | NDFUKVXJILPQFK-AWEZNQCLSA-N |
| XLogP | 4.55 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|