C28H25N5O4 — CID 170095336
N-[[4-(nitrosocarbamoyl)phenyl]methyl]-N-(4-quinolin-7-ylphenyl)morpholine-4-carboxamide (PubChem CID 170095336) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-[[4-(nitrosocarbamoyl)phenyl]methyl]-N-(4-quinolin-7-ylphenyl)morpholine-4-carboxamide.
| Compound Name | N-[[4-(nitrosocarbamoyl)phenyl]methyl]-N-(4-quinolin-7-ylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 170095336 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[[4-(nitrosocarbamoyl)phenyl]methyl]-N-(4-quinolin-7-ylphenyl)morpholine-4-carboxamide |
| SMILES | O=NNC(=O)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(-c3ccc4cccnc4c3)cc2)cc1 |
| InChI | InChI=1S/C28H25N5O4/c34-27(30-31-36)23-5-3-20(4-6-23)19-33(28(35)32-14-16-37-17-15-32)25-11-9-21(10-12-25)24-8-7-22-2-1-13-29-26(22)18-24/h1-13,18H,14-17,19H2,(H,30,34,36) |
| InChIKey | BMCIKNSYKBQVLE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|