C13H20N4O2 — CID 83210815
2-[(1-pyridin-4-ylpiperidin-4-yl)amino]ethyl carbamate (PubChem CID 83210815) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[(1-pyridin-4-ylpiperidin-4-yl)amino]ethyl carbamate.
| Compound Name | 2-[(1-pyridin-4-ylpiperidin-4-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83210815 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-[(1-pyridin-4-ylpiperidin-4-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C13H20N4O2/c14-13(18)19-10-7-16-11-3-8-17(9-4-11)12-1-5-15-6-2-12/h1-2,5-6,11,16H,3-4,7-10H2,(H2,14,18) |
| InChIKey | JLJFUOYQVQFLOY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|