C26H35N5O4 — CID 42483061
ethyl 4-[4-[4-(2-pyridin-3-yloxyethylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate (PubChem CID 42483061) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is ethyl 4-[4-[4-(2-pyridin-3-yloxyethylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[4-(2-pyridin-3-yloxyethylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42483061 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | ethyl 4-[4-[4-(2-pyridin-3-yloxyethylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(N3CCC(NCCOc4cccnc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H35N5O4/c1-2-34-26(33)31-17-15-30(16-18-31)25(32)21-5-7-23(8-6-21)29-13-9-22(10-14-29)28-12-19-35-24-4-3-11-27-20-24/h3-8,11,20,22,28H,2,9-10,12-19H2,1H3 |
| InChIKey | IRKXJPFPNQOWCE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|