C27H37N5O3 — CID 42162659
ethyl 4-[4-[4-(3-pyridin-3-ylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate (PubChem CID 42162659) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is ethyl 4-[4-[4-(3-pyridin-3-ylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[4-(3-pyridin-3-ylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42162659 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | ethyl 4-[4-[4-(3-pyridin-3-ylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(N3CCC(NCCCc4cccnc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H37N5O3/c1-2-35-27(34)32-19-17-31(18-20-32)26(33)23-7-9-25(10-8-23)30-15-11-24(12-16-30)29-14-4-6-22-5-3-13-28-21-22/h3,5,7-10,13,21,24,29H,2,4,6,11-12,14-20H2,1H3 |
| InChIKey | NEHWNDKETCQBJK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|