C26H34N4O — CID 26402975
4-[4-[2-(cyclohexen-1-yl)ethylamino]piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 26402975) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 4-[4-[2-(cyclohexen-1-yl)ethylamino]piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[4-[2-(cyclohexen-1-yl)ethylamino]piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 26402975 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 4-[4-[2-(cyclohexen-1-yl)ethylamino]piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccnc1)c1ccc(N2CCC(NCCC3=CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H34N4O/c31-26(29-20-22-7-4-15-27-19-22)23-8-10-25(11-9-23)30-17-13-24(14-18-30)28-16-12-21-5-2-1-3-6-21/h4-5,7-11,15,19,24,28H,1-3,6,12-14,16-18,20H2,(H,29,31) |
| InChIKey | SVQRUOSQARNXQJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|