C28H32N6O — CID 42169432
4-[4-(3-indazol-1-ylpropylamino)piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42169432) has the molecular formula C28H32N6O and a molecular weight of 468.61 g/mol. Its IUPAC name is 4-[4-(3-indazol-1-ylpropylamino)piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[4-(3-indazol-1-ylpropylamino)piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42169432 |
| Molecular Formula | C28H32N6O |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 4-[4-(3-indazol-1-ylpropylamino)piperidin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccnc1)c1ccc(N2CCC(NCCCn3ncc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C28H32N6O/c35-28(31-20-22-5-3-14-29-19-22)23-8-10-26(11-9-23)33-17-12-25(13-18-33)30-15-4-16-34-27-7-2-1-6-24(27)21-32-34/h1-3,5-11,14,19,21,25,30H,4,12-13,15-18,20H2,(H,31,35) |
| InChIKey | ZAKMRRZTAKDHGT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|