C23H29N5O2 — CID 118754298
(2S)-1-[1-[4-(pyridin-3-ylmethylcarbamoyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 118754298) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (2S)-1-[1-[4-(pyridin-3-ylmethylcarbamoyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[1-[4-(pyridin-3-ylmethylcarbamoyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118754298 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (2S)-1-[1-[4-(pyridin-3-ylmethylcarbamoyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1C1CCN(c2ccc(C(=O)NCc3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c24-22(29)21-4-2-12-28(21)20-9-13-27(14-10-20)19-7-5-18(6-8-19)23(30)26-16-17-3-1-11-25-15-17/h1,3,5-8,11,15,20-21H,2,4,9-10,12-14,16H2,(H2,24,29)(H,26,30)/t21-/m0/s1 |
| InChIKey | LZUQDVGPOTWQDK-NRFANRHFSA-N |
| XLogP | 1.93 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |