C28H38N4O3 — CID 45174868
ethyl 4-[4-[4-(2-phenylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate (PubChem CID 45174868) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is ethyl 4-[4-[4-(2-phenylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[4-(2-phenylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 45174868 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | ethyl 4-[4-[4-(2-phenylpropylamino)piperidin-1-yl]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(N3CCC(NCC(C)c4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H38N4O3/c1-3-35-28(34)32-19-17-31(18-20-32)27(33)24-9-11-26(12-10-24)30-15-13-25(14-16-30)29-21-22(2)23-7-5-4-6-8-23/h4-12,22,25,29H,3,13-21H2,1-2H3 |
| InChIKey | ZJAVKDCCBLIXRB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |