C20H24N4O2 — CID 110400478
N-(2-morpholin-4-yl-5-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide (PubChem CID 110400478) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-5-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide.
| Compound Name | N-(2-morpholin-4-yl-5-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110400478 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-(2-morpholin-4-yl-5-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(N2CCCC2)ccc1N1CCOCC1)c1ccncc1 |
| InChI | InChI=1S/C20H24N4O2/c25-20(16-5-7-21-8-6-16)22-18-15-17(23-9-1-2-10-23)3-4-19(18)24-11-13-26-14-12-24/h3-8,15H,1-2,9-14H2,(H,22,25) |
| InChIKey | SSDAWLBHZMZJJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|