C26H28N8O2S — CID 58930578
5-[2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]pyrimidin-4-yl]-N-[(dimethylamino)methyl]-4-methyl-1,3-thiazole-2-carboxamide (PubChem CID 58930578) has the molecular formula C26H28N8O2S and a molecular weight of 516.63 g/mol. Its IUPAC name is 5-[2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]pyrimidin-4-yl]-N-[(dimethylamino)methyl]-4-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | 5-[2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]pyrimidin-4-yl]-N-[(dimethylamino)methyl]-4-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58930578 |
| Molecular Formula | C26H28N8O2S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 5-[2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]pyrimidin-4-yl]-N-[(dimethylamino)methyl]-4-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(=O)NCN(C)C)sc1-c1ccnc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)n1 |
| InChI | InChI=1S/C26H28N8O2S/c1-16-22(37-25(31-16)24(36)30-15-34(2)3)21-12-13-28-26(33-21)29-14-17-8-10-18(11-9-17)23(35)32-20-7-5-4-6-19(20)27/h4-13H,14-15,27H2,1-3H3,(H,30,36)(H,32,35)(H,28,29,33) |
| InChIKey | ZSZIOXVACHVNSI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|