C25H23N5O2 — CID 42625734
methyl 4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]methyl]benzoate (PubChem CID 42625734) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]methyl]benzoate.
| Compound Name | methyl 4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]methyl]benzoate |
|---|---|
| PubChem CID | 42625734 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | methyl 4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2ccc(C)c(Nc3nccc(-c4cccnc4)n3)c2)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-17-5-10-21(28-15-18-6-8-19(9-7-18)24(31)32-2)14-23(17)30-25-27-13-11-22(29-25)20-4-3-12-26-16-20/h3-14,16,28H,15H2,1-2H3,(H,27,29,30) |
| InChIKey | KGVCNWNMZFPZRF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |