C20H20N6O5 — CID 25060637
2-nitrooxyethyl 2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]acetate (PubChem CID 25060637) has the molecular formula C20H20N6O5 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-nitrooxyethyl 2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]acetate.
| Compound Name | 2-nitrooxyethyl 2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]acetate |
|---|---|
| PubChem CID | 25060637 |
| Molecular Formula | C20H20N6O5 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-nitrooxyethyl 2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]anilino]acetate |
| SMILES | Cc1ccc(NCC(=O)OCCO[N+](=O)[O-])cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C20H20N6O5/c1-14-4-5-16(23-13-19(27)30-9-10-31-26(28)29)11-18(14)25-20-22-8-6-17(24-20)15-3-2-7-21-12-15/h2-8,11-12,23H,9-10,13H2,1H3,(H,22,24,25) |
| InChIKey | OACIJIYHXISLEL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|