C27H25ClF6N2O — CID 142983647
2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-(2,3-dimethylphenyl)-3-pyridinyl]-N,2-dimethylbutanamide (PubChem CID 142983647) has the molecular formula C27H25ClF6N2O and a molecular weight of 542.95 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-(2,3-dimethylphenyl)-3-pyridinyl]-N,2-dimethylbutanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-(2,3-dimethylphenyl)-3-pyridinyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 142983647 |
| Molecular Formula | C27H25ClF6N2O |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-(2,3-dimethylphenyl)-3-pyridinyl]-N,2-dimethylbutanamide |
| SMILES | CCC(C)(C(=O)N(C)c1cnc(Cl)cc1-c1cccc(C)c1C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H25ClF6N2O/c1-6-25(4,17-10-18(26(29,30)31)12-19(11-17)27(32,33)34)24(37)36(5)22-14-35-23(28)13-21(22)20-9-7-8-15(2)16(20)3/h7-14H,6H2,1-5H3 |
| InChIKey | HHXCCLPJRCFFKM-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|