C31H24ClF7N2O — CID 87091236
N-[6-chloro-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethyl-2,3-bis[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 87091236) has the molecular formula C31H24ClF7N2O and a molecular weight of 608.99 g/mol. Its IUPAC name is N-[6-chloro-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethyl-2,3-bis[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-[6-chloro-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethyl-2,3-bis[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 87091236 |
| Molecular Formula | C31H24ClF7N2O |
| Molecular Weight | 608.99 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | N-[6-chloro-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethyl-2,3-bis[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1cc(F)ccc1-c1cc(Cl)ncc1N(C)C(=O)C(C)(Cc1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C31H24ClF7N2O/c1-18-14-20(33)12-13-21(18)22-15-27(32)40-17-26(22)41(3)28(42)29(2,24-10-6-7-11-25(24)31(37,38)39)16-19-8-4-5-9-23(19)30(34,35)36/h4-15,17H,16H2,1-3H3 |
| InChIKey | RZMPHUZGHJVTLE-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.99 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|