C24H20F6N2O — CID 57046615
N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)benzamide (PubChem CID 57046615) has the molecular formula C24H20F6N2O and a molecular weight of 466.43 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)benzamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)benzamide |
|---|---|
| PubChem CID | 57046615 |
| Molecular Formula | C24H20F6N2O |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-(N-methylanilino)benzamide |
| SMILES | CN(c1ccccc1)c1ccccc1C(=O)NCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F6N2O/c1-32(19-7-3-2-4-8-19)21-10-6-5-9-20(21)22(33)31-12-11-16-13-17(23(25,26)27)15-18(14-16)24(28,29)30/h2-10,13-15H,11-12H2,1H3,(H,31,33) |
| InChIKey | ZUGAUXJEGPGRQQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |