C11H12N2O2 — CID 172792494
1-(2-hydroxyethyl)indole-3-carboxamide (PubChem CID 172792494) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)indole-3-carboxamide.
| Compound Name | 1-(2-hydroxyethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 172792494 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-(2-hydroxyethyl)indole-3-carboxamide |
| SMILES | NC(=O)c1cn(CCO)c2ccccc12 |
| InChI | InChI=1S/C11H12N2O2/c12-11(15)9-7-13(5-6-14)10-4-2-1-3-8(9)10/h1-4,7,14H,5-6H2,(H2,12,15) |
| InChIKey | PTJPJCRQICROQZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |