C19H21N3O2 — CID 56878336
1-[2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]indole-3-carboxamide (PubChem CID 56878336) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]indole-3-carboxamide.
| Compound Name | 1-[2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 56878336 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-oxoethyl]indole-3-carboxamide |
| SMILES | NC(=O)c1cn(CC(=O)N2C[C@H]3CC=CC[C@H]3C2)c2ccccc12 |
| InChI | InChI=1S/C19H21N3O2/c20-19(24)16-11-21(17-8-4-3-7-15(16)17)12-18(23)22-9-13-5-1-2-6-14(13)10-22/h1-4,7-8,11,13-14H,5-6,9-10,12H2,(H2,20,24)/t13-,14+ |
| InChIKey | RVMBLZHDXRMMKB-OKILXGFUSA-N |
| XLogP | 2.16 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|