C22H16N4O3 — CID 10915982
2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide (PubChem CID 10915982) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide.
| Compound Name | 2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 10915982 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3ccc(C#N)cc3)c3ccccc23)on1 |
| InChI | InChI=1S/C22H16N4O3/c1-14-10-20(29-25-14)24-22(28)21(27)18-13-26(19-5-3-2-4-17(18)19)12-16-8-6-15(11-23)7-9-16/h2-10,13H,12H2,1H3,(H,24,28) |
| InChIKey | JHRMHLBMPDEAGT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|