C25H18N4OS — CID 1073628
(Z)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 1073628) has the molecular formula C25H18N4OS and a molecular weight of 422.51 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 1073628 |
| Molecular Formula | C25H18N4OS |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(Cc2ccc(C#N)cc2)c2ccccc12)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C25H18N4OS/c26-13-18-7-9-19(10-8-18)16-29-17-21(23-5-1-2-6-24(23)29)12-20(14-27)25(30)28-15-22-4-3-11-31-22/h1-12,17H,15-16H2,(H,28,30)/b20-12- |
| InChIKey | UZMDTMGXZSCQGC-NDENLUEZSA-N |
| XLogP | 4.85 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|