C27H21N3O3 — CID 124646319
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enamide (PubChem CID 124646319) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 124646319 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(1-benzylindol-3-yl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cn(Cc2ccccc2)c2ccccc12)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H21N3O3/c28-14-21(27(31)29-15-20-10-11-25-26(12-20)33-18-32-25)13-22-17-30(16-19-6-2-1-3-7-19)24-9-5-4-8-23(22)24/h1-13,17H,15-16,18H2,(H,29,31)/b21-13+ |
| InChIKey | CEYDQPGHDYZXPV-FYJGNVAPSA-N |
| XLogP | 4.64 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|