C27H18N4O2 — CID 23397135
2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide (PubChem CID 23397135) has the molecular formula C27H18N4O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide.
| Compound Name | 2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide |
|---|---|
| PubChem CID | 23397135 |
| Molecular Formula | C27H18N4O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[1-[(4-cyanophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide |
| SMILES | N#Cc1ccc(Cn2cc(C(=O)C(=O)Nc3ccc4ncccc4c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H18N4O2/c28-15-18-7-9-19(10-8-18)16-31-17-23(22-5-1-2-6-25(22)31)26(32)27(33)30-21-11-12-24-20(14-21)4-3-13-29-24/h1-14,17H,16H2,(H,30,33) |
| InChIKey | XIKNRXYQRLOAQD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|