C25H17ClN4O2 — CID 20730291
[2-[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]-1H-imidazol-5-yl]-pyridin-2-ylmethanone (PubChem CID 20730291) has the molecular formula C25H17ClN4O2 and a molecular weight of 440.89 g/mol. Its IUPAC name is [2-[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]-1H-imidazol-5-yl]-pyridin-2-ylmethanone.
| Compound Name | [2-[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]-1H-imidazol-5-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 20730291 |
| Molecular Formula | C25H17ClN4O2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [2-[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]-1H-imidazol-5-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)c1cnc(C(=O)c2cn(Cc3ccc(Cl)cc3)c3ccccc23)[nH]1 |
| InChI | InChI=1S/C25H17ClN4O2/c26-17-10-8-16(9-11-17)14-30-15-19(18-5-1-2-7-22(18)30)23(31)25-28-13-21(29-25)24(32)20-6-3-4-12-27-20/h1-13,15H,14H2,(H,28,29) |
| InChIKey | LCPRPDTWPCMNDJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |