C25H19ClN4O2 — CID 67244328
[1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridin-2-ylpyrazol-3-yl)methanone (PubChem CID 67244328) has the molecular formula C25H19ClN4O2 and a molecular weight of 442.91 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridin-2-ylpyrazol-3-yl)methanone.
| Compound Name | [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridin-2-ylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 67244328 |
| Molecular Formula | C25H19ClN4O2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridin-2-ylpyrazol-3-yl)methanone |
| SMILES | COc1ccc2c(c1)c(C(=O)c1ccn(-c3ccccn3)n1)cn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN4O2/c1-32-19-9-10-23-20(14-19)21(16-29(23)15-17-5-7-18(26)8-6-17)25(31)22-11-13-30(28-22)24-4-2-3-12-27-24/h2-14,16H,15H2,1H3 |
| InChIKey | WTHDQLUNKPMVOL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |