C23H17ClN6O2 — CID 67242796
[1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-4-yltriazol-4-yl)methanone (PubChem CID 67242796) has the molecular formula C23H17ClN6O2 and a molecular weight of 444.88 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-4-yltriazol-4-yl)methanone.
| Compound Name | [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-4-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 67242796 |
| Molecular Formula | C23H17ClN6O2 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-4-yltriazol-4-yl)methanone |
| SMILES | COc1ccc2c(c1)c(C(=O)c1cn(-c3ccnnc3)nn1)cn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN6O2/c1-32-18-6-7-22-19(10-18)20(13-29(22)12-15-2-4-16(24)5-3-15)23(31)21-14-30(28-27-21)17-8-9-25-26-11-17/h2-11,13-14H,12H2,1H3 |
| InChIKey | FCUZPUQBOHEPSI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |