C24H18ClN5O2 — CID 67244342
[1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-3-ylpyrazol-4-yl)methanone (PubChem CID 67244342) has the molecular formula C24H18ClN5O2 and a molecular weight of 443.89 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-3-ylpyrazol-4-yl)methanone.
| Compound Name | [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-3-ylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 67244342 |
| Molecular Formula | C24H18ClN5O2 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-(1-pyridazin-3-ylpyrazol-4-yl)methanone |
| SMILES | COc1ccc2c(c1)c(C(=O)c1cnn(-c3cccnn3)c1)cn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClN5O2/c1-32-19-8-9-22-20(11-19)21(15-29(22)13-16-4-6-18(25)7-5-16)24(31)17-12-27-30(14-17)23-3-2-10-26-28-23/h2-12,14-15H,13H2,1H3 |
| InChIKey | RURBUAACWVBDGY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |