C12H14Br2O2 — CID 22111697
phenyl 2,6-dibromohexanoate (PubChem CID 22111697) has the molecular formula C12H14Br2O2 and a molecular weight of 350.05 g/mol. Its IUPAC name is phenyl 2,6-dibromohexanoate.
| Compound Name | phenyl 2,6-dibromohexanoate |
|---|---|
| PubChem CID | 22111697 |
| Molecular Formula | C12H14Br2O2 |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | phenyl 2,6-dibromohexanoate |
| SMILES | O=C(Oc1ccccc1)C(Br)CCCCBr |
| InChI | InChI=1S/C12H14Br2O2/c13-9-5-4-8-11(14)12(15)16-10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
| InChIKey | DXFWWQBKZRGPEG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|