C9H8Cl2O2 — CID 15055281
phenyl 2,3-dichloropropanoate (PubChem CID 15055281) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is phenyl 2,3-dichloropropanoate.
| Compound Name | phenyl 2,3-dichloropropanoate |
|---|---|
| PubChem CID | 15055281 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | phenyl 2,3-dichloropropanoate |
| SMILES | O=C(Oc1ccccc1)C(Cl)CCl |
| InChI | InChI=1S/C9H8Cl2O2/c10-6-8(11)9(12)13-7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | FKIITUBWYLAEQH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|