C21H31N3O5 — CID 174208820
4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperazine-1-carboxylic acid (PubChem CID 174208820) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174208820 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(CCCOC2CCN(C(=O)OCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C21H31N3O5/c25-20(26)23-14-12-22(13-15-23)9-4-16-28-19-7-10-24(11-8-19)21(27)29-17-18-5-2-1-3-6-18/h1-3,5-6,19H,4,7-17H2,(H,25,26) |
| InChIKey | FLFCTORUCOYPIT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|