C20H28N2O6 — CID 58495785
4-O-benzyl 1-O-[2-(oxan-4-yloxy)ethyl] piperazine-1,4-dicarboxylate (PubChem CID 58495785) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[2-(oxan-4-yloxy)ethyl] piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-benzyl 1-O-[2-(oxan-4-yloxy)ethyl] piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58495785 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-O-benzyl 1-O-[2-(oxan-4-yloxy)ethyl] piperazine-1,4-dicarboxylate |
| SMILES | O=C(OCCOC1CCOCC1)N1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N2O6/c23-19(27-15-14-26-18-6-12-25-13-7-18)21-8-10-22(11-9-21)20(24)28-16-17-4-2-1-3-5-17/h1-5,18H,6-16H2 |
| InChIKey | CNLJIBFZWUPZEK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|