C21H29NO6 — CID 66990374
2-[2-(oxan-4-yloxy)ethyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid (PubChem CID 66990374) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 2-[2-(oxan-4-yloxy)ethyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid.
| Compound Name | 2-[2-(oxan-4-yloxy)ethyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 66990374 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[2-(oxan-4-yloxy)ethyl]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)OCc2ccccc2)C(CCOC2CCOCC2)C1 |
| InChI | InChI=1S/C21H29NO6/c23-20(24)17-6-10-22(21(25)28-15-16-4-2-1-3-5-16)18(14-17)7-13-27-19-8-11-26-12-9-19/h1-5,17-19H,6-15H2,(H,23,24) |
| InChIKey | QWXGYDBEKSZOSI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |