C20H31ClN2O3 — CID 11058072
benzyl (2S)-2-(2-piperidin-1-ium-4-yloxyethyl)piperidine-1-carboxylate chloride (PubChem CID 11058072) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is benzyl (2S)-2-(2-piperidin-1-ium-4-yloxyethyl)piperidine-1-carboxylate chloride.
| Compound Name | benzyl (2S)-2-(2-piperidin-1-ium-4-yloxyethyl)piperidine-1-carboxylate chloride |
|---|---|
| PubChem CID | 11058072 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | benzyl (2S)-2-(2-piperidin-1-ium-4-yloxyethyl)piperidine-1-carboxylate chloride |
| SMILES | O=C(OCc1ccccc1)N1CCCC[C@H]1CCOC1CC[NH2+]CC1.[Cl-] |
| InChI | InChI=1S/C20H30N2O3.ClH/c23-20(25-16-17-6-2-1-3-7-17)22-14-5-4-8-18(22)11-15-24-19-9-12-21-13-10-19;/h1-3,6-7,18-19,21H,4-5,8-16H2;1H/t18-;/m0./s1 |
| InChIKey | GMUAGMPUEJOOOB-FERBBOLQSA-N |
| XLogP | -0.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |