C21H31NO5 — CID 129385196
benzyl (2R)-2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperidine-1-carboxylate (PubChem CID 129385196) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is benzyl (2R)-2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 129385196 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | benzyl (2R)-2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)COCC[C@H]1CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31NO5/c1-21(2,3)27-19(23)16-25-14-12-18-11-7-8-13-22(18)20(24)26-15-17-9-5-4-6-10-17/h4-6,9-10,18H,7-8,11-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | XJHRVYHKNYWBCX-GOSISDBHSA-N |
| XLogP | 3.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|