C20H27NO5 — CID 171065423
1-O-benzyl 4-O-(oxan-4-ylmethyl) piperidine-1,4-dicarboxylate (PubChem CID 171065423) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-O-benzyl 4-O-(oxan-4-ylmethyl) piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-(oxan-4-ylmethyl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 171065423 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-O-benzyl 4-O-(oxan-4-ylmethyl) piperidine-1,4-dicarboxylate |
| SMILES | O=C(OCC1CCOCC1)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H27NO5/c22-19(25-14-17-8-12-24-13-9-17)18-6-10-21(11-7-18)20(23)26-15-16-4-2-1-3-5-16/h1-5,17-18H,6-15H2 |
| InChIKey | PQFWWKCALYTNAM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |