C35H51N3O4 — CID 142021447
benzyl N-(1-methylpiperidin-4-yl)-N-prop-2-enylcarbamate;(3S)-1-(cyclohexylmethyl)-3-phenylpyrrolidine;formic acid (PubChem CID 142021447) has the molecular formula C35H51N3O4 and a molecular weight of 577.81 g/mol. Its IUPAC name is benzyl N-(1-methylpiperidin-4-yl)-N-prop-2-enylcarbamate;(3S)-1-(cyclohexylmethyl)-3-phenylpyrrolidine;formic acid.
| Compound Name | benzyl N-(1-methylpiperidin-4-yl)-N-prop-2-enylcarbamate;(3S)-1-(cyclohexylmethyl)-3-phenylpyrrolidine;formic acid |
|---|---|
| PubChem CID | 142021447 |
| Molecular Formula | C35H51N3O4 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.39 |
| IUPAC Name | benzyl N-(1-methylpiperidin-4-yl)-N-prop-2-enylcarbamate;(3S)-1-(cyclohexylmethyl)-3-phenylpyrrolidine;formic acid |
| SMILES | C=CCN(C(=O)OCc1ccccc1)C1CCN(C)CC1.O=CO.c1ccc([C@@H]2CCN(CC3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C17H24N2O2.C17H25N.CH2O2/c1-3-11-19(16-9-12-18(2)13-10-16)17(20)21-14-15-7-5-4-6-8-15;1-3-7-15(8-4-1)13-18-12-11-17(14-18)16-9-5-2-6-10-16;2-1-3/h3-8,16H,1,9-14H2,2H3;2,5-6,9-10,15,17H,1,3-4,7-8,11-14H2;1H,(H,2,3)/t;17-;/m.1./s1 |
| InChIKey | WLKJKGLJEQSPDG-VVARQKSHSA-N |
| XLogP | 6.66 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|