C37H44N4O5 — CID 18372805
(4-nitrophenyl)methyl N-[1-[[4-[methyl-(2-phenylacetyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 18372805) has the molecular formula C37H44N4O5 and a molecular weight of 624.78 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[[4-[methyl-(2-phenylacetyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[[4-[methyl-(2-phenylacetyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 18372805 |
| Molecular Formula | C37H44N4O5 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[[4-[methyl-(2-phenylacetyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CC2CC(N(C)C(=O)Cc3ccccc3)CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C37H44N4O5/c1-3-20-40(37(43)46-27-29-14-16-33(17-15-29)41(44)45)32-18-21-39(22-19-32)26-31-24-34(25-35(31)30-12-8-5-9-13-30)38(2)36(42)23-28-10-6-4-7-11-28/h3-17,31-32,34-35H,1,18-27H2,2H3 |
| InChIKey | MKGFMOSSUROEMU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|