C34H48Cl2N4O6 — CID 70157486
2-[2-methylpropyl-[3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]-4-phenylcyclopentyl]amino]acetic acid;dihydrochloride (PubChem CID 70157486) has the molecular formula C34H48Cl2N4O6 and a molecular weight of 679.69 g/mol. Its IUPAC name is 2-[2-methylpropyl-[3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]-4-phenylcyclopentyl]amino]acetic acid;dihydrochloride.
| Compound Name | 2-[2-methylpropyl-[3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]-4-phenylcyclopentyl]amino]acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 70157486 |
| Molecular Formula | C34H48Cl2N4O6 |
| Molecular Weight | 679.69 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | 2-[2-methylpropyl-[3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]-4-phenylcyclopentyl]amino]acetic acid;dihydrochloride |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CC2CC(N(CC(=O)O)CC(C)C)CC2c2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C34H46N4O6.2ClH/c1-4-16-37(34(41)44-24-26-10-12-30(13-11-26)38(42)43)29-14-17-35(18-15-29)22-28-19-31(36(21-25(2)3)23-33(39)40)20-32(28)27-8-6-5-7-9-27;;/h4-13,25,28-29,31-32H,1,14-24H2,2-3H3,(H,39,40);2*1H |
| InChIKey | HZDLAVLZZDVGDM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.69 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|