C35H42N4O5 — CID 18345135
[4-(hydroperoxyamino)phenyl]methyl N-[1-[(4-benzamido-2-phenylcyclopentyl)methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 18345135) has the molecular formula C35H42N4O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is [4-(hydroperoxyamino)phenyl]methyl N-[1-[(4-benzamido-2-phenylcyclopentyl)methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | [4-(hydroperoxyamino)phenyl]methyl N-[1-[(4-benzamido-2-phenylcyclopentyl)methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 18345135 |
| Molecular Formula | C35H42N4O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | [4-(hydroperoxyamino)phenyl]methyl N-[1-[(4-benzamido-2-phenylcyclopentyl)methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc(NOO)cc1)C1CCN(CC2CC(NC(=O)c3ccccc3)CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C35H42N4O5/c1-2-19-39(35(41)43-25-26-13-15-30(16-14-26)37-44-42)32-17-20-38(21-18-32)24-29-22-31(23-33(29)27-9-5-3-6-10-27)36-34(40)28-11-7-4-8-12-28/h2-16,29,31-33,37,42H,1,17-25H2,(H,36,40) |
| InChIKey | CRSGTCOOWDCLSK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|