C36H50N4O5 — CID 59925474
N-[1-[[(1S,2S)-4-[acetyl(cyclohexyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-2-[4-(hydroperoxyamino)phenoxy]-N-prop-2-enylacetamide (PubChem CID 59925474) has the molecular formula C36H50N4O5 and a molecular weight of 618.82 g/mol. Its IUPAC name is N-[1-[[(1S,2S)-4-[acetyl(cyclohexyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-2-[4-(hydroperoxyamino)phenoxy]-N-prop-2-enylacetamide.
| Compound Name | N-[1-[[(1S,2S)-4-[acetyl(cyclohexyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-2-[4-(hydroperoxyamino)phenoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 59925474 |
| Molecular Formula | C36H50N4O5 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | N-[1-[[(1S,2S)-4-[acetyl(cyclohexyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-2-[4-(hydroperoxyamino)phenoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)COc1ccc(NOO)cc1)C1CCN(C[C@H]2CC(N(C(C)=O)C3CCCCC3)C[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C36H50N4O5/c1-3-20-39(36(42)26-44-34-16-14-30(15-17-34)37-45-43)31-18-21-38(22-19-31)25-29-23-33(24-35(29)28-10-6-4-7-11-28)40(27(2)41)32-12-8-5-9-13-32/h3-4,6-7,10-11,14-17,29,31-33,35,37,43H,1,5,8-9,12-13,18-26H2,2H3/t29-,33?,35-/m1/s1 |
| InChIKey | RAEPQLOVXOICST-MXUZRRSASA-N |
| XLogP | 6.10 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|