C34H43N5O5S — CID 18345122
1-[1-[[4-(benzenesulfonamido)-2-phenylcyclopentyl]methyl]piperidin-4-yl]-3-[[4-(hydroperoxyamino)phenyl]methyl]-1-prop-2-enylurea (PubChem CID 18345122) has the molecular formula C34H43N5O5S and a molecular weight of 633.82 g/mol. Its IUPAC name is 1-[1-[[4-(benzenesulfonamido)-2-phenylcyclopentyl]methyl]piperidin-4-yl]-3-[[4-(hydroperoxyamino)phenyl]methyl]-1-prop-2-enylurea.
| Compound Name | 1-[1-[[4-(benzenesulfonamido)-2-phenylcyclopentyl]methyl]piperidin-4-yl]-3-[[4-(hydroperoxyamino)phenyl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 18345122 |
| Molecular Formula | C34H43N5O5S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | 1-[1-[[4-(benzenesulfonamido)-2-phenylcyclopentyl]methyl]piperidin-4-yl]-3-[[4-(hydroperoxyamino)phenyl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccc(NOO)cc1)C1CCN(CC2CC(NS(=O)(=O)c3ccccc3)CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C34H43N5O5S/c1-2-19-39(34(40)35-24-26-13-15-29(16-14-26)36-44-41)31-17-20-38(21-18-31)25-28-22-30(23-33(28)27-9-5-3-6-10-27)37-45(42,43)32-11-7-4-8-12-32/h2-16,28,30-31,33,36-37,41H,1,17-25H2,(H,35,40) |
| InChIKey | CXDOPTXADXDFPQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|