C19H30N4O4S — CID 143836411
1-[3-[hydroxy(methyl)amino]cycloheptyl]-1-prop-2-enyl-3-[(4-sulfamoylphenyl)methyl]urea (PubChem CID 143836411) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-[3-[hydroxy(methyl)amino]cycloheptyl]-1-prop-2-enyl-3-[(4-sulfamoylphenyl)methyl]urea.
| Compound Name | 1-[3-[hydroxy(methyl)amino]cycloheptyl]-1-prop-2-enyl-3-[(4-sulfamoylphenyl)methyl]urea |
|---|---|
| PubChem CID | 143836411 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[3-[hydroxy(methyl)amino]cycloheptyl]-1-prop-2-enyl-3-[(4-sulfamoylphenyl)methyl]urea |
| SMILES | C=CCN(C(=O)NCc1ccc(S(N)(=O)=O)cc1)C1CCCCC(N(C)O)C1 |
| InChI | InChI=1S/C19H30N4O4S/c1-3-12-23(17-7-5-4-6-16(13-17)22(2)25)19(24)21-14-15-8-10-18(11-9-15)28(20,26)27/h3,8-11,16-17,25H,1,4-7,12-14H2,2H3,(H,21,24)(H2,20,26,27) |
| InChIKey | WILOZPAUHXZJOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|