C28H41N3O6 — CID 142033721
3-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]methyl]butanoic acid (PubChem CID 142033721) has the molecular formula C28H41N3O6 and a molecular weight of 515.65 g/mol. Its IUPAC name is 3-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]methyl]butanoic acid.
| Compound Name | 3-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 142033721 |
| Molecular Formula | C28H41N3O6 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | 3-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]methyl]butanoic acid |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@@H]2CCC(CC(C(=O)O)C(C)C)C2)CC1 |
| InChI | InChI=1S/C28H41N3O6/c1-4-13-30(28(34)37-19-21-7-9-25(10-8-21)31(35)36)24-11-14-29(15-12-24)18-23-6-5-22(16-23)17-26(20(2)3)27(32)33/h4,7-10,20,22-24,26H,1,5-6,11-19H2,2-3H3,(H,32,33)/t22?,23-,26?/m1/s1 |
| InChIKey | QQMHDRRKKPQEFG-VVCJCJSVSA-N |
| XLogP | 5.35 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|