C33H49N3O4S — CID 54287098
(4-methylphenyl)methyl N-[1-[4-[butoxysulfinyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 54287098) has the molecular formula C33H49N3O4S and a molecular weight of 583.84 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-[1-[4-[butoxysulfinyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-methylphenyl)methyl N-[1-[4-[butoxysulfinyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 54287098 |
| Molecular Formula | C33H49N3O4S |
| Molecular Weight | 583.84 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | (4-methylphenyl)methyl N-[1-[4-[butoxysulfinyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc(C)cc1)C1CCN(CCC(C)(CN(C)S(=O)OCCCC)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H49N3O4S/c1-6-8-25-40-41(38)34(5)27-33(4,30-12-10-9-11-13-30)20-24-35-22-18-31(19-23-35)36(21-7-2)32(37)39-26-29-16-14-28(3)15-17-29/h7,9-17,31H,2,6,8,18-27H2,1,3-5H3 |
| InChIKey | VAXTXAJKHTWWSE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.84 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|