C32H45N3O3 — CID 89231029
N-[3-hydroxy-3-phenyl-5-[4-[(2-phenylacetyl)-prop-2-enylamino]piperidin-1-yl]pentyl]-2,2-dimethylpropanamide (PubChem CID 89231029) has the molecular formula C32H45N3O3 and a molecular weight of 519.73 g/mol. Its IUPAC name is N-[3-hydroxy-3-phenyl-5-[4-[(2-phenylacetyl)-prop-2-enylamino]piperidin-1-yl]pentyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-hydroxy-3-phenyl-5-[4-[(2-phenylacetyl)-prop-2-enylamino]piperidin-1-yl]pentyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 89231029 |
| Molecular Formula | C32H45N3O3 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | N-[3-hydroxy-3-phenyl-5-[4-[(2-phenylacetyl)-prop-2-enylamino]piperidin-1-yl]pentyl]-2,2-dimethylpropanamide |
| SMILES | C=CCN(C(=O)Cc1ccccc1)C1CCN(CCC(O)(CCNC(=O)C(C)(C)C)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H45N3O3/c1-5-21-35(29(36)25-26-12-8-6-9-13-26)28-16-22-34(23-17-28)24-19-32(38,27-14-10-7-11-15-27)18-20-33-30(37)31(2,3)4/h5-15,28,38H,1,16-25H2,2-4H3,(H,33,37) |
| InChIKey | OZNSREYOPWORBC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|