C23H36N2O — CID 142909540
buta-1,3-diene;2-phenyl-N-piperidin-4-yl-N-prop-2-enylacetamide;propane (PubChem CID 142909540) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is buta-1,3-diene;2-phenyl-N-piperidin-4-yl-N-prop-2-enylacetamide;propane.
| Compound Name | buta-1,3-diene;2-phenyl-N-piperidin-4-yl-N-prop-2-enylacetamide;propane |
|---|---|
| PubChem CID | 142909540 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | buta-1,3-diene;2-phenyl-N-piperidin-4-yl-N-prop-2-enylacetamide;propane |
| SMILES | C=CC=C.C=CCN(C(=O)Cc1ccccc1)C1CCNCC1.CCC |
| InChI | InChI=1S/C16H22N2O.C4H6.C3H8/c1-2-12-18(15-8-10-17-11-9-15)16(19)13-14-6-4-3-5-7-14;1-3-4-2;1-3-2/h2-7,15,17H,1,8-13H2;3-4H,1-2H2;3H2,1-2H3 |
| InChIKey | XPUYWXDEDSQROI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|